C21H20Cl2N4O3 — CID 135264654
1-(2,5-dichlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindol-5-yl]methyl]urea (PubChem CID 135264654) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindol-5-yl]methyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 135264654 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindol-5-yl]methyl]urea |
| SMILES | O=C1CCC(N2Cc3ccc(CNC(=O)Nc4cc(Cl)ccc4Cl)cc3C2)C(=O)N1 |
| InChI | InChI=1S/C21H20Cl2N4O3/c22-15-3-4-16(23)17(8-15)25-21(30)24-9-12-1-2-13-10-27(11-14(13)7-12)18-5-6-19(28)26-20(18)29/h1-4,7-8,18H,5-6,9-11H2,(H2,24,25,30)(H,26,28,29) |
| InChIKey | FZVJQBDSJSSXES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|