C21H19ClN4O4 — CID 67023304
N-[(4-chlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide (PubChem CID 67023304) has the molecular formula C21H19ClN4O4 and a molecular weight of 426.86 g/mol. Its IUPAC name is N-[(4-chlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 67023304 |
| Molecular Formula | C21H19ClN4O4 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[(4-chlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(C(=O)NC(=O)Nc4ccc(Cl)cc4)cc3C2)C(=O)N1 |
| InChI | InChI=1S/C21H19ClN4O4/c22-15-3-5-16(6-4-15)23-21(30)25-19(28)12-1-2-13-10-26(11-14(13)9-12)17-7-8-18(27)24-20(17)29/h1-6,9,17H,7-8,10-11H2,(H,24,27,29)(H2,23,25,28,30) |
| InChIKey | ZJYNAEAQTLMNJY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|