C22H31N5O4 — CID 66589503
N-[3-(diethylamino)propylcarbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide (PubChem CID 66589503) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[3-(diethylamino)propylcarbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-[3-(diethylamino)propylcarbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 66589503 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[3-(diethylamino)propylcarbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)NC(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C22H31N5O4/c1-3-26(4-2)11-5-10-23-22(31)25-20(29)15-6-7-16-13-27(14-17(16)12-15)18-8-9-19(28)24-21(18)30/h6-7,12,18H,3-5,8-11,13-14H2,1-2H3,(H,24,28,30)(H2,23,25,29,31) |
| InChIKey | COJPFAFUIWADDS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|