C22H19F3N4O3S2 — CID 87240350
2-(2,6-dioxopiperidin-3-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1,3-dihydroisoindole-5-carboxamide (PubChem CID 87240350) has the molecular formula C22H19F3N4O3S2 and a molecular weight of 508.55 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 87240350 |
| Molecular Formula | C22H19F3N4O3S2 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1,3-dihydroisoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(C(=O)NC(=S)Nc4ccc(SC(F)(F)F)cc4)cc3C2)C(=O)N1 |
| InChI | InChI=1S/C22H19F3N4O3S2/c23-22(24,25)34-16-5-3-15(4-6-16)26-21(33)28-19(31)12-1-2-13-10-29(11-14(13)9-12)17-7-8-18(30)27-20(17)32/h1-6,9,17H,7-8,10-11H2,(H,27,30,32)(H2,26,28,31,33) |
| InChIKey | IWOXOTPABKWMBP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|