C22H21ClN4O4 — CID 166425888
N-(2,3-dihydro-1H-indol-6-yl)-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;hydrochloride (PubChem CID 166425888) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-6-yl)-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;hydrochloride.
| Compound Name | N-(2,3-dihydro-1H-indol-6-yl)-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 166425888 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-6-yl)-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C1CCC(N2Cc3cc(C(=O)Nc4ccc5c(c4)NCC5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H20N4O4.ClH/c27-19-6-5-18(21(29)25-19)26-11-14-9-13(2-4-16(14)22(26)30)20(28)24-15-3-1-12-7-8-23-17(12)10-15;/h1-4,9-10,18,23H,5-8,11H2,(H,24,28)(H,25,27,29);1H |
| InChIKey | SENPXAUQEVKWRO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|