C26H27N5O6 — CID 176972033
N-[4,6-di(cyclobutyloxy)pyrimidin-2-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 176972033) has the molecular formula C26H27N5O6 and a molecular weight of 505.53 g/mol. Its IUPAC name is N-[4,6-di(cyclobutyloxy)pyrimidin-2-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[4,6-di(cyclobutyloxy)pyrimidin-2-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 176972033 |
| Molecular Formula | C26H27N5O6 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[4,6-di(cyclobutyloxy)pyrimidin-2-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)Nc4nc(OC5CCC5)cc(OC5CCC5)n4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H27N5O6/c32-20-10-9-19(24(34)27-20)31-13-15-11-14(7-8-18(15)25(31)35)23(33)30-26-28-21(36-16-3-1-4-16)12-22(29-26)37-17-5-2-6-17/h7-8,11-12,16-17,19H,1-6,9-10,13H2,(H,27,32,34)(H,28,29,30,33) |
| InChIKey | YJWXWIWJZAEPET-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|