C23H23N5O5 — CID 176971937
2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[4-(oxolan-3-ylmethyl)pyrimidin-2-yl]-3H-isoindole-5-carboxamide (PubChem CID 176971937) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[4-(oxolan-3-ylmethyl)pyrimidin-2-yl]-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[4-(oxolan-3-ylmethyl)pyrimidin-2-yl]-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 176971937 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[4-(oxolan-3-ylmethyl)pyrimidin-2-yl]-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)Nc4nccc(CC5CCOC5)n4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H23N5O5/c29-19-4-3-18(21(31)26-19)28-11-15-10-14(1-2-17(15)22(28)32)20(30)27-23-24-7-5-16(25-23)9-13-6-8-33-12-13/h1-2,5,7,10,13,18H,3-4,6,8-9,11-12H2,(H,26,29,31)(H,24,25,27,30) |
| InChIKey | PJJGLYXPVUSFPA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|