C25H22N4O4 — CID 134536902
N-carbamoyl-2-(2,6-dioxopiperidin-3-yl)-N-naphthalen-2-yl-1,3-dihydroisoindole-5-carboxamide (PubChem CID 134536902) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-carbamoyl-2-(2,6-dioxopiperidin-3-yl)-N-naphthalen-2-yl-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-carbamoyl-2-(2,6-dioxopiperidin-3-yl)-N-naphthalen-2-yl-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 134536902 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-carbamoyl-2-(2,6-dioxopiperidin-3-yl)-N-naphthalen-2-yl-1,3-dihydroisoindole-5-carboxamide |
| SMILES | NC(=O)N(C(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H22N4O4/c26-25(33)29(20-8-7-15-3-1-2-4-16(15)12-20)24(32)17-5-6-18-13-28(14-19(18)11-17)21-9-10-22(30)27-23(21)31/h1-8,11-12,21H,9-10,13-14H2,(H2,26,33)(H,27,30,31) |
| InChIKey | TVSVUDJSIHXECN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|