C15H15N3O3 — CID 142469980
3-[7-(aminomethyl)-1-oxoisoquinolin-2-yl]piperidine-2,6-dione (PubChem CID 142469980) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[7-(aminomethyl)-1-oxoisoquinolin-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(aminomethyl)-1-oxoisoquinolin-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142469980 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[7-(aminomethyl)-1-oxoisoquinolin-2-yl]piperidine-2,6-dione |
| SMILES | NCc1ccc2ccn(C3CCC(=O)NC3=O)c(=O)c2c1 |
| InChI | InChI=1S/C15H15N3O3/c16-8-9-1-2-10-5-6-18(15(21)11(10)7-9)12-3-4-13(19)17-14(12)20/h1-2,5-7,12H,3-4,8,16H2,(H,17,19,20) |
| InChIKey | YWSUKMSTJWGPHI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|