C24H23FN4O4 — CID 151176246
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-7-yl]methyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 151176246) has the molecular formula C24H23FN4O4 and a molecular weight of 450.47 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-7-yl]methyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-7-yl]methyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 151176246 |
| Molecular Formula | C24H23FN4O4 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxoisoquinolin-7-yl]methyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | O=C1CCC(n2ccc3ccc(CNC(=O)NCCc4ccc(F)cc4)cc3c2=O)C(=O)N1 |
| InChI | InChI=1S/C24H23FN4O4/c25-18-5-2-15(3-6-18)9-11-26-24(33)27-14-16-1-4-17-10-12-29(23(32)19(17)13-16)20-7-8-21(30)28-22(20)31/h1-6,10,12-13,20H,7-9,11,14H2,(H2,26,27,33)(H,28,30,31) |
| InChIKey | NDHZONOYMNROPP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|