C16H16N2O3 — CID 166478748
(3R)-3-(6-ethyl-1-oxoisoquinolin-2-yl)piperidine-2,6-dione (PubChem CID 166478748) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is (3R)-3-(6-ethyl-1-oxoisoquinolin-2-yl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(6-ethyl-1-oxoisoquinolin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166478748 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3R)-3-(6-ethyl-1-oxoisoquinolin-2-yl)piperidine-2,6-dione |
| SMILES | CCc1ccc2c(=O)n([C@@H]3CCC(=O)NC3=O)ccc2c1 |
| InChI | InChI=1S/C16H16N2O3/c1-2-10-3-4-12-11(9-10)7-8-18(16(12)21)13-5-6-14(19)17-15(13)20/h3-4,7-9,13H,2,5-6H2,1H3,(H,17,19,20)/t13-/m1/s1 |
| InChIKey | HHNNXYVLVRWYHC-CYBMUJFWSA-N |
| XLogP | 1.54 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|