C22H27N5O5 — CID 175430667
4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]-2-methylpropan-2-yl]piperazine-1-carboxylic acid (PubChem CID 175430667) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]-2-methylpropan-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]-2-methylpropan-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175430667 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]-2-methylpropan-2-yl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(Cc1ccc2c(=O)n(C3CCC(=O)NC3=O)ncc2c1)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C22H27N5O5/c1-22(2,26-9-7-25(8-10-26)21(31)32)12-14-3-4-16-15(11-14)13-23-27(20(16)30)17-5-6-18(28)24-19(17)29/h3-4,11,13,17H,5-10,12H2,1-2H3,(H,31,32)(H,24,28,29) |
| InChIKey | BIYBJPJBHRRRQJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|