C12H12ClN3O2 — CID 155251099
3-indazol-1-ylpiperidine-2,6-dione;hydrochloride (PubChem CID 155251099) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 3-indazol-1-ylpiperidine-2,6-dione;hydrochloride.
| Compound Name | 3-indazol-1-ylpiperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 155251099 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-indazol-1-ylpiperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(n2ncc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C12H11N3O2.ClH/c16-11-6-5-10(12(17)14-11)15-9-4-2-1-3-8(9)7-13-15;/h1-4,7,10H,5-6H2,(H,14,16,17);1H |
| InChIKey | PMRKIYKAQMIQBM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|