C12H11N3O2 — CID 138467082
3-indazol-2-ylpiperidine-2,6-dione (PubChem CID 138467082) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-indazol-2-ylpiperidine-2,6-dione.
| Compound Name | 3-indazol-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 138467082 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-indazol-2-ylpiperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc3ccccc3n2)C(=O)N1 |
| InChI | InChI=1S/C12H11N3O2/c16-11-6-5-10(12(17)13-11)15-7-8-3-1-2-4-9(8)14-15/h1-4,7,10H,5-6H2,(H,13,16,17) |
| InChIKey | HRKTYZUEYCGSFG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|