C14H13N3O3 — CID 129210548
(3S)-3-(5-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 129210548) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is (3S)-3-(5-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | (3S)-3-(5-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 129210548 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (3S)-3-(5-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1cccc2ncn([C@H]3CCC(=O)NC3=O)c(=O)c12 |
| InChI | InChI=1S/C14H13N3O3/c1-8-3-2-4-9-12(8)14(20)17(7-15-9)10-5-6-11(18)16-13(10)19/h2-4,7,10H,5-6H2,1H3,(H,16,18,19)/t10-/m0/s1 |
| InChIKey | PNFLHEPSSARJRC-JTQLQIEISA-N |
| XLogP | 0.68 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|