C28H34N6O3 — CID 156837203
3-[4-oxo-5-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]methylamino]quinazolin-3-yl]piperidine-2,6-dione (PubChem CID 156837203) has the molecular formula C28H34N6O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is 3-[4-oxo-5-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]methylamino]quinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-oxo-5-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]methylamino]quinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156837203 |
| Molecular Formula | C28H34N6O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 3-[4-oxo-5-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]methylamino]quinazolin-3-yl]piperidine-2,6-dione |
| SMILES | CC(C)N1CCN(Cc2ccc(CNc3cccc4ncn(C5CCC(=O)NC5=O)c(=O)c34)cc2)CC1 |
| InChI | InChI=1S/C28H34N6O3/c1-19(2)33-14-12-32(13-15-33)17-21-8-6-20(7-9-21)16-29-22-4-3-5-23-26(22)28(37)34(18-30-23)24-10-11-25(35)31-27(24)36/h3-9,18-19,24,29H,10-17H2,1-2H3,(H,31,35,36) |
| InChIKey | HHJMJSAFVDGDCD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|