C13H10FN3O3 — CID 156837320
3-(5-fluoro-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 156837320) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is 3-(5-fluoro-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-fluoro-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 156837320 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-(5-fluoro-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cnc3cccc(F)c3c2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10FN3O3/c14-7-2-1-3-8-11(7)13(20)17(6-15-8)9-4-5-10(18)16-12(9)19/h1-3,6,9H,4-5H2,(H,16,18,19) |
| InChIKey | LOZBPQULIUZHAS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|