C25H28N6O4 — CID 168859118
3-[2-methyl-5-[[5-(morpholin-4-ylmethyl)-2-pyridinyl]methylamino]-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 168859118) has the molecular formula C25H28N6O4 and a molecular weight of 476.54 g/mol. Its IUPAC name is 3-[2-methyl-5-[[5-(morpholin-4-ylmethyl)-2-pyridinyl]methylamino]-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-methyl-5-[[5-(morpholin-4-ylmethyl)-2-pyridinyl]methylamino]-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168859118 |
| Molecular Formula | C25H28N6O4 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 3-[2-methyl-5-[[5-(morpholin-4-ylmethyl)-2-pyridinyl]methylamino]-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(NCc3ccc(CN4CCOCC4)cn3)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H28N6O4/c1-16-28-20-4-2-3-19(23(20)25(34)31(16)21-7-8-22(32)29-24(21)33)27-14-18-6-5-17(13-26-18)15-30-9-11-35-12-10-30/h2-6,13,21,27H,7-12,14-15H2,1H3,(H,29,32,33) |
| InChIKey | JGHJMIVYRXZYJB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|