C15H13HgN4O4 — CID 144668416
[3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-5-yl]carbamoylmercury (PubChem CID 144668416) has the molecular formula C15H13HgN4O4 and a molecular weight of 513.88 g/mol. Its IUPAC name is [3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-5-yl]carbamoylmercury.
| Compound Name | [3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-5-yl]carbamoylmercury |
|---|---|
| PubChem CID | 144668416 |
| Molecular Formula | C15H13HgN4O4 |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | [3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-5-yl]carbamoylmercury |
| SMILES | Cc1nc2cccc(NC(=O)[Hg])c2c(=O)n1[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H13N4O4.Hg/c1-8-17-10-4-2-3-9(16-7-20)13(10)15(23)19(8)11-5-6-12(21)18-14(11)22;/h2-4,11H,5-6H2,1H3,(H,16,20)(H,18,21,22);/t11-;/m1./s1 |
| InChIKey | IVGOSJZXOOBUHM-RFVHGSKJSA-N |
| XLogP | 0.76 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|