C21H25IN3O3- — CID 164567289
(3R)-3-(5-cycloheptyliodanuidyl-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 164567289) has the molecular formula C21H25IN3O3- and a molecular weight of 494.35 g/mol. Its IUPAC name is (3R)-3-(5-cycloheptyliodanuidyl-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(5-cycloheptyliodanuidyl-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164567289 |
| Molecular Formula | C21H25IN3O3- |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (3R)-3-(5-cycloheptyliodanuidyl-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cccc([I-]C3CCCCCC3)c2c(=O)n1[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H25IN3O3/c1-13-23-16-10-6-9-15(22-14-7-4-2-3-5-8-14)19(16)21(28)25(13)17-11-12-18(26)24-20(17)27/h6,9-10,14,17H,2-5,7-8,11-12H2,1H3,(H,24,26,27)/q-1/t17-/m1/s1 |
| InChIKey | KTVYSGXCXFYFPE-QGZVFWFLSA-N |
| XLogP | -0.34 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|