C15H13N5O3 — CID 146338206
5-amino-3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazoline-7-carbonitrile (PubChem CID 146338206) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 5-amino-3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazoline-7-carbonitrile.
| Compound Name | 5-amino-3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazoline-7-carbonitrile |
|---|---|
| PubChem CID | 146338206 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-amino-3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazoline-7-carbonitrile |
| SMILES | Cc1nc2cc(C#N)cc(N)c2c(=O)n1[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H13N5O3/c1-7-18-10-5-8(6-16)4-9(17)13(10)15(23)20(7)11-2-3-12(21)19-14(11)22/h4-5,11H,2-3,17H2,1H3,(H,19,21,22)/t11-/m1/s1 |
| InChIKey | NTMZVULXIMYDOB-LLVKDONJSA-N |
| XLogP | 0.14 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|