C14H11BrN4O5 — CID 146338228
3-(7-bromo-2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 146338228) has the molecular formula C14H11BrN4O5 and a molecular weight of 395.17 g/mol. Its IUPAC name is 3-(7-bromo-2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-bromo-2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 146338228 |
| Molecular Formula | C14H11BrN4O5 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 3-(7-bromo-2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cc(Br)cc([N+](=O)[O-])c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H11BrN4O5/c1-6-16-8-4-7(15)5-10(19(23)24)12(8)14(22)18(6)9-2-3-11(20)17-13(9)21/h4-5,9H,2-3H2,1H3,(H,17,20,21) |
| InChIKey | GEEBORXFYQPHKJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|