C23H21FN4O4 — CID 66656780
N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-(fluoromethyl)benzamide (PubChem CID 66656780) has the molecular formula C23H21FN4O4 and a molecular weight of 436.44 g/mol. Its IUPAC name is N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-(fluoromethyl)benzamide.
| Compound Name | N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-(fluoromethyl)benzamide |
|---|---|
| PubChem CID | 66656780 |
| Molecular Formula | C23H21FN4O4 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-(fluoromethyl)benzamide |
| SMILES | Cc1nc2cccc(CNC(=O)c3ccc(CF)cc3)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H21FN4O4/c1-13-26-17-4-2-3-16(12-25-21(30)15-7-5-14(11-24)6-8-15)20(17)23(32)28(13)18-9-10-19(29)27-22(18)31/h2-8,18H,9-12H2,1H3,(H,25,30)(H,27,29,31) |
| InChIKey | BYMAAFREHLZWDU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|