C30H41N5O4 — CID 170239674
4-[[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]methyl]-N-(3-ethylhex-5-en-3-yl)cyclohexane-1-carboxamide (PubChem CID 170239674) has the molecular formula C30H41N5O4 and a molecular weight of 535.69 g/mol. Its IUPAC name is 4-[[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]methyl]-N-(3-ethylhex-5-en-3-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]methyl]-N-(3-ethylhex-5-en-3-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 170239674 |
| Molecular Formula | C30H41N5O4 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | 4-[[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]methyl]-N-(3-ethylhex-5-en-3-yl)cyclohexane-1-carboxamide |
| SMILES | C=CCC(CC)(CC)NC(=O)C1CCC(CNc2cccc3nc(C)n(C4CCC(=O)NC4=O)c(=O)c23)CC1 |
| InChI | InChI=1S/C30H41N5O4/c1-5-17-30(6-2,7-3)34-27(37)21-13-11-20(12-14-21)18-31-22-9-8-10-23-26(22)29(39)35(19(4)32-23)24-15-16-25(36)33-28(24)38/h5,8-10,20-21,24,31H,1,6-7,11-18H2,2-4H3,(H,34,37)(H,33,36,38) |
| InChIKey | DGKSCVFISXOFPA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|