C21H27N5O5 — CID 175406178
6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexyl carbamate (PubChem CID 175406178) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexyl carbamate.
| Compound Name | 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexyl carbamate |
|---|---|
| PubChem CID | 175406178 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexyl carbamate |
| SMILES | Cc1nc2cccc(NCCCCCCOC(N)=O)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H27N5O5/c1-13-24-15-8-6-7-14(23-11-4-2-3-5-12-31-21(22)30)18(15)20(29)26(13)16-9-10-17(27)25-19(16)28/h6-8,16,23H,2-5,9-12H2,1H3,(H2,22,30)(H,25,27,28) |
| InChIKey | YGOOHSLVEDKFTP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|