C29H39N5O3S — CID 169093644
(3S)-3-[5-[[(3S)-5-(1-adamantylamino)-3-sulfanylpentyl]amino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 169093644) has the molecular formula C29H39N5O3S and a molecular weight of 537.73 g/mol. Its IUPAC name is (3S)-3-[5-[[(3S)-5-(1-adamantylamino)-3-sulfanylpentyl]amino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[5-[[(3S)-5-(1-adamantylamino)-3-sulfanylpentyl]amino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169093644 |
| Molecular Formula | C29H39N5O3S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (3S)-3-[5-[[(3S)-5-(1-adamantylamino)-3-sulfanylpentyl]amino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(NCC[C@@H](S)CCNC34CC5CC(CC(C5)C3)C4)c2c(=O)n1[C@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H39N5O3S/c1-17-32-23-4-2-3-22(26(23)28(37)34(17)24-5-6-25(35)33-27(24)36)30-9-7-21(38)8-10-31-29-14-18-11-19(15-29)13-20(12-18)16-29/h2-4,18-21,24,30-31,38H,5-16H2,1H3,(H,33,35,36)/t18?,19?,20?,21-,24+,29?/m1/s1 |
| InChIKey | HLZYHVPBTVWGEN-VJCMSNTNSA-N |
| XLogP | 3.73 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|