C31H39F3N4O4 — CID 169093844
3-[5-[7-(1-adamantylamino)heptoxy]-4-oxo-2-(trifluoromethyl)quinazolin-3-yl]piperidine-2,6-dione (PubChem CID 169093844) has the molecular formula C31H39F3N4O4 and a molecular weight of 588.67 g/mol. Its IUPAC name is 3-[5-[7-(1-adamantylamino)heptoxy]-4-oxo-2-(trifluoromethyl)quinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[7-(1-adamantylamino)heptoxy]-4-oxo-2-(trifluoromethyl)quinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169093844 |
| Molecular Formula | C31H39F3N4O4 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 3-[5-[7-(1-adamantylamino)heptoxy]-4-oxo-2-(trifluoromethyl)quinazolin-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(C(F)(F)F)nc3cccc(OCCCCCCCNC45CC6CC(CC(C6)C4)C5)c3c2=O)C(=O)N1 |
| InChI | InChI=1S/C31H39F3N4O4/c32-31(33,34)29-36-22-7-6-8-24(26(22)28(41)38(29)23-9-10-25(39)37-27(23)40)42-12-5-3-1-2-4-11-35-30-16-19-13-20(17-30)15-21(14-19)18-30/h6-8,19-21,23,35H,1-5,9-18H2,(H,37,39,40) |
| InChIKey | XBMLROBMWLBRRC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|