C32H40N4O3 — CID 169093753
3-[6-[8-(1-adamantylamino)oct-1-ynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 169093753) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is 3-[6-[8-(1-adamantylamino)oct-1-ynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[8-(1-adamantylamino)oct-1-ynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169093753 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 3-[6-[8-(1-adamantylamino)oct-1-ynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2ccc(C#CCCCCCCNC34CC5CC(CC(C5)C3)C4)cc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C32H40N4O3/c1-21-34-27-10-9-22(17-26(27)31(39)36(21)28-11-12-29(37)35-30(28)38)8-6-4-2-3-5-7-13-33-32-18-23-14-24(19-32)16-25(15-23)20-32/h9-10,17,23-25,28,33H,2-5,7,11-16,18-20H2,1H3,(H,35,37,38) |
| InChIKey | ZBWXCLJIEKGEGW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|