C20H19N5O4 — CID 142748655
3-[5-[(4-methoxyphenyl)methylamino]-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione (PubChem CID 142748655) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-[5-[(4-methoxyphenyl)methylamino]-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[(4-methoxyphenyl)methylamino]-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142748655 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[5-[(4-methoxyphenyl)methylamino]-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione |
| SMILES | COc1ccc(CNc2cccc3nnn(C4CCC(=O)NC4=O)c(=O)c23)cc1 |
| InChI | InChI=1S/C20H19N5O4/c1-29-13-7-5-12(6-8-13)11-21-14-3-2-4-15-18(14)20(28)25(24-23-15)16-9-10-17(26)22-19(16)27/h2-8,16,21H,9-11H2,1H3,(H,22,26,27) |
| InChIKey | SAHDIFYXHRJZRO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|