C35H48N6O11 — CID 162767844
4-[2-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide (PubChem CID 162767844) has the molecular formula C35H48N6O11 and a molecular weight of 728.80 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide.
| Compound Name | 4-[2-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 162767844 |
| Molecular Formula | C35H48N6O11 |
| Molecular Weight | 728.80 g/mol |
| Exact Mass | 728.34 |
| IUPAC Name | 4-[2-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCCOCCOCCOCCOCCOCCOCCCCNc2cccc3nnn(C4CCC(=O)NC4=O)c(=O)c23)cc1 |
| InChI | InChI=1S/C35H48N6O11/c36-33(43)26-6-8-27(9-7-26)52-25-24-51-23-22-50-21-20-49-19-18-48-17-16-47-15-14-46-13-2-1-12-37-28-4-3-5-29-32(28)35(45)41(40-39-29)30-10-11-31(42)38-34(30)44/h3-9,30,37H,1-2,10-25H2,(H2,36,43)(H,38,42,44) |
| InChIKey | IAQXTYPOKDAUSP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 213.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.80 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|