C33H44N6O10 — CID 162767698
4-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide (PubChem CID 162767698) has the molecular formula C33H44N6O10 and a molecular weight of 684.75 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide.
| Compound Name | 4-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 162767698 |
| Molecular Formula | C33H44N6O10 |
| Molecular Weight | 684.75 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | 4-[2-[2-[2-[2-[2-[4-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCCOCCOCCOCCOCCOCCCCNc2cccc3nnn(C4CCC(=O)NC4=O)c(=O)c23)cc1 |
| InChI | InChI=1S/C33H44N6O10/c34-31(41)24-6-8-25(9-7-24)49-23-22-48-21-20-47-19-18-46-17-16-45-15-14-44-13-2-1-12-35-26-4-3-5-27-30(26)33(43)39(38-37-27)28-10-11-29(40)36-32(28)42/h3-9,28,35H,1-2,10-23H2,(H2,34,41)(H,36,40,42) |
| InChIKey | HPSODNSGYWGQFN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 204.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|