C19H22N4O5 — CID 171637123
6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]hexanoic acid (PubChem CID 171637123) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]hexanoic acid.
| Compound Name | 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 171637123 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1cccc2cnn(C3CCC(=O)NC3=O)c(=O)c12 |
| InChI | InChI=1S/C19H22N4O5/c24-15-9-8-14(18(27)22-15)23-19(28)17-12(11-21-23)5-4-6-13(17)20-10-3-1-2-7-16(25)26/h4-6,11,14,20H,1-3,7-10H2,(H,25,26)(H,22,24,27) |
| InChIKey | SWPHNESXCUDTCA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|