C24H32N6O6 — CID 166142021
3-[1-oxo-8-[2-[2-(3-oxo-3-piperazin-1-ylpropoxy)ethoxy]ethylamino]phthalazin-2-yl]piperidine-2,6-dione (PubChem CID 166142021) has the molecular formula C24H32N6O6 and a molecular weight of 500.56 g/mol. Its IUPAC name is 3-[1-oxo-8-[2-[2-(3-oxo-3-piperazin-1-ylpropoxy)ethoxy]ethylamino]phthalazin-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-oxo-8-[2-[2-(3-oxo-3-piperazin-1-ylpropoxy)ethoxy]ethylamino]phthalazin-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166142021 |
| Molecular Formula | C24H32N6O6 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-[1-oxo-8-[2-[2-(3-oxo-3-piperazin-1-ylpropoxy)ethoxy]ethylamino]phthalazin-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2ncc3cccc(NCCOCCOCCC(=O)N4CCNCC4)c3c2=O)C(=O)N1 |
| InChI | InChI=1S/C24H32N6O6/c31-20-5-4-19(23(33)28-20)30-24(34)22-17(16-27-30)2-1-3-18(22)26-9-13-36-15-14-35-12-6-21(32)29-10-7-25-8-11-29/h1-3,16,19,25-26H,4-15H2,(H,28,31,33) |
| InChIKey | LHWROXFYABSKHX-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|