C22H29N5O6 — CID 175430674
1-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]ethoxy]ethyl N-tert-butylcarbamate (PubChem CID 175430674) has the molecular formula C22H29N5O6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 1-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]ethoxy]ethyl N-tert-butylcarbamate.
| Compound Name | 1-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]ethoxy]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175430674 |
| Molecular Formula | C22H29N5O6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-5-yl]amino]ethoxy]ethyl N-tert-butylcarbamate |
| SMILES | CC(OCCNc1cccc2cnn(C3CCC(=O)NC3=O)c(=O)c12)OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H29N5O6/c1-13(33-21(31)26-22(2,3)4)32-11-10-23-15-7-5-6-14-12-24-27(20(30)18(14)15)16-8-9-17(28)25-19(16)29/h5-7,12-13,16,23H,8-11H2,1-4H3,(H,26,31)(H,25,28,29) |
| InChIKey | AHTLTWJVTTZQGY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|