C16H16N4O6 — CID 175430666
2-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-5-yl]oxyethyl carbamate (PubChem CID 175430666) has the molecular formula C16H16N4O6 and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-5-yl]oxyethyl carbamate.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-5-yl]oxyethyl carbamate |
|---|---|
| PubChem CID | 175430666 |
| Molecular Formula | C16H16N4O6 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-5-yl]oxyethyl carbamate |
| SMILES | NC(=O)OCCOc1cccc2c(=O)n(C3CCC(=O)NC3=O)ncc12 |
| InChI | InChI=1S/C16H16N4O6/c17-16(24)26-7-6-25-12-3-1-2-9-10(12)8-18-20(15(9)23)11-4-5-13(21)19-14(11)22/h1-3,8,11H,4-7H2,(H2,17,24)(H,19,21,22) |
| InChIKey | JUWUFCBHWJFVCB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|