C12H9N3O3 — CID 178180661
3-(1-oxophthalazin-2-yl)pyrrolidine-2,5-dione (PubChem CID 178180661) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 3-(1-oxophthalazin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(1-oxophthalazin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 178180661 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-(1-oxophthalazin-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(n2ncc3ccccc3c2=O)C(=O)N1 |
| InChI | InChI=1S/C12H9N3O3/c16-10-5-9(11(17)14-10)15-12(18)8-4-2-1-3-7(8)6-13-15/h1-4,6,9H,5H2,(H,14,16,17) |
| InChIKey | BZTIBHDZZPSKFS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|