C11H8N2O3S — CID 56843403
3-(3-oxo-1,2-benzothiazol-2-yl)pyrrolidine-2,5-dione (PubChem CID 56843403) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 3-(3-oxo-1,2-benzothiazol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-oxo-1,2-benzothiazol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 56843403 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 3-(3-oxo-1,2-benzothiazol-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(n2sc3ccccc3c2=O)C(=O)N1 |
| InChI | InChI=1S/C11H8N2O3S/c14-9-5-7(10(15)12-9)13-11(16)6-3-1-2-4-8(6)17-13/h1-4,7H,5H2,(H,12,14,15) |
| InChIKey | OBWLEJMXKDSQIV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|