C13H18N4O4 — CID 5093773
3-[4-(2,5-dioxopyrrolidin-3-yl)-1,4-diazepan-1-yl]pyrrolidine-2,5-dione (PubChem CID 5093773) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[4-(2,5-dioxopyrrolidin-3-yl)-1,4-diazepan-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(2,5-dioxopyrrolidin-3-yl)-1,4-diazepan-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5093773 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-[4-(2,5-dioxopyrrolidin-3-yl)-1,4-diazepan-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCCN(C3CC(=O)NC3=O)CC2)C(=O)N1 |
| InChI | InChI=1S/C13H18N4O4/c18-10-6-8(12(20)14-10)16-2-1-3-17(5-4-16)9-7-11(19)15-13(9)21/h8-9H,1-7H2,(H,14,18,20)(H,15,19,21) |
| InChIKey | LLOYRASVQWRXBU-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|