C15H25N3O2 — CID 177057043
3-(4-piperidin-4-ylpiperidin-1-yl)piperidine-2,6-dione (PubChem CID 177057043) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-(4-piperidin-4-ylpiperidin-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-piperidin-4-ylpiperidin-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 177057043 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3-(4-piperidin-4-ylpiperidin-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CCC(C3CCNCC3)CC2)C(=O)N1 |
| InChI | InChI=1S/C15H25N3O2/c19-14-2-1-13(15(20)17-14)18-9-5-12(6-10-18)11-3-7-16-8-4-11/h11-13,16H,1-10H2,(H,17,19,20) |
| InChIKey | KGZXLBWYTPOTJC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|