C17H26N4O3 — CID 134580084
3-[(6R)-6-[(1E)-1-piperazin-1-ylbuta-1,3-dienyl]-1,3-oxazinan-3-yl]piperidine-2,6-dione (PubChem CID 134580084) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[(6R)-6-[(1E)-1-piperazin-1-ylbuta-1,3-dienyl]-1,3-oxazinan-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[(6R)-6-[(1E)-1-piperazin-1-ylbuta-1,3-dienyl]-1,3-oxazinan-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134580084 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-[(6R)-6-[(1E)-1-piperazin-1-ylbuta-1,3-dienyl]-1,3-oxazinan-3-yl]piperidine-2,6-dione |
| SMILES | C=C/C=C(\[C@H]1CCN(C2CCC(=O)NC2=O)CO1)N1CCNCC1 |
| InChI | InChI=1S/C17H26N4O3/c1-2-3-13(20-10-7-18-8-11-20)15-6-9-21(12-24-15)14-4-5-16(22)19-17(14)23/h2-3,14-15,18H,1,4-12H2,(H,19,22,23)/b13-3+/t14?,15-/m1/s1 |
| InChIKey | VIBUSEOEESLYRY-VRLPNJQTSA-N |
| XLogP | -0.18 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|