C10H12N2O2S — CID 142623303
3-[(1E)-1-(methylideneamino)buta-1,3-dienyl]sulfanylpiperidine-2,6-dione (PubChem CID 142623303) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-[(1E)-1-(methylideneamino)buta-1,3-dienyl]sulfanylpiperidine-2,6-dione.
| Compound Name | 3-[(1E)-1-(methylideneamino)buta-1,3-dienyl]sulfanylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 142623303 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-[(1E)-1-(methylideneamino)buta-1,3-dienyl]sulfanylpiperidine-2,6-dione |
| SMILES | C=C/C=C(\N=C)SC1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H12N2O2S/c1-3-4-9(11-2)15-7-5-6-8(13)12-10(7)14/h3-4,7H,1-2,5-6H2,(H,12,13,14)/b9-4+ |
| InChIKey | XFWPEVUXWSWDAZ-RUDMXATFSA-N |
| XLogP | 1.25 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|