C16H26N2O3 — CID 176695806
(2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethenylpenta-2,4-dienamide;ethane (PubChem CID 176695806) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethenylpenta-2,4-dienamide;ethane.
| Compound Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethenylpenta-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 176695806 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethenylpenta-2,4-dienamide;ethane |
| SMILES | C=C/C=C(\C=C)C(=O)NC1CCC(=O)NC1=O.CC.CC |
| InChI | InChI=1S/C12H14N2O3.2C2H6/c1-3-5-8(4-2)11(16)13-9-6-7-10(15)14-12(9)17;2*1-2/h3-5,9H,1-2,6-7H2,(H,13,16)(H,14,15,17);2*1-2H3/b8-5+;; |
| InChIKey | NLYUKGRCPUECOI-RMZRELHQSA-N |
| XLogP | 2.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|