C13H20N2O2 — CID 172570194
ethane;3-[(2Z)-1-methyliminopenta-2,4-dien-2-yl]piperidine-2,6-dione (PubChem CID 172570194) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethane;3-[(2Z)-1-methyliminopenta-2,4-dien-2-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[(2Z)-1-methyliminopenta-2,4-dien-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172570194 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | ethane;3-[(2Z)-1-methyliminopenta-2,4-dien-2-yl]piperidine-2,6-dione |
| SMILES | C=C/C=C(\C=N\C)C1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C11H14N2O2.C2H6/c1-3-4-8(7-12-2)9-5-6-10(14)13-11(9)15;1-2/h3-4,7,9H,1,5-6H2,2H3,(H,13,14,15);1-2H3/b8-4+,12-7+; |
| InChIKey | MZHBJRCNLYPAIL-LSACGIPASA-N |
| XLogP | 1.88 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|