C19H31NO3 — CID 177240487
buta-1,3-diene;3-(4,5-dimethylfuran-3-yl)piperidine-2,6-dione;ethane (PubChem CID 177240487) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is buta-1,3-diene;3-(4,5-dimethylfuran-3-yl)piperidine-2,6-dione;ethane.
| Compound Name | buta-1,3-diene;3-(4,5-dimethylfuran-3-yl)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 177240487 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | buta-1,3-diene;3-(4,5-dimethylfuran-3-yl)piperidine-2,6-dione;ethane |
| SMILES | C=CC=C.CC.CC.Cc1occ(C2CCC(=O)NC2=O)c1C |
| InChI | InChI=1S/C11H13NO3.C4H6.2C2H6/c1-6-7(2)15-5-9(6)8-3-4-10(13)12-11(8)14;1-3-4-2;2*1-2/h5,8H,3-4H2,1-2H3,(H,12,13,14);3-4H,1-2H2;2*1-2H3 |
| InChIKey | GACUOLWMSWQKFI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|