C15H13NO4 — CID 167071398
3-(8-methyl-2-oxochromen-4-yl)piperidine-2,6-dione (PubChem CID 167071398) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-(8-methyl-2-oxochromen-4-yl)piperidine-2,6-dione.
| Compound Name | 3-(8-methyl-2-oxochromen-4-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167071398 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(8-methyl-2-oxochromen-4-yl)piperidine-2,6-dione |
| SMILES | Cc1cccc2c(C3CCC(=O)NC3=O)cc(=O)oc12 |
| InChI | InChI=1S/C15H13NO4/c1-8-3-2-4-9-11(7-13(18)20-14(8)9)10-5-6-12(17)16-15(10)19/h2-4,7,10H,5-6H2,1H3,(H,16,17,19) |
| InChIKey | VZXSCAUKRRPVIT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|