C15H20N2O2 — CID 170144934
3-(6-tert-butyl-2-methyl-3-pyridinyl)piperidine-2,6-dione (PubChem CID 170144934) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(6-tert-butyl-2-methyl-3-pyridinyl)piperidine-2,6-dione.
| Compound Name | 3-(6-tert-butyl-2-methyl-3-pyridinyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170144934 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-(6-tert-butyl-2-methyl-3-pyridinyl)piperidine-2,6-dione |
| SMILES | Cc1nc(C(C)(C)C)ccc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H20N2O2/c1-9-10(5-7-12(16-9)15(2,3)4)11-6-8-13(18)17-14(11)19/h5,7,11H,6,8H2,1-4H3,(H,17,18,19) |
| InChIKey | MRADYEWRNKTXRC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|