C14H12ClN3O2 — CID 177017366
3-(6-chloro-2-methyl-1,5-naphthyridin-3-yl)piperidine-2,6-dione (PubChem CID 177017366) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 3-(6-chloro-2-methyl-1,5-naphthyridin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-chloro-2-methyl-1,5-naphthyridin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017366 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(6-chloro-2-methyl-1,5-naphthyridin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2ccc(Cl)nc2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H12ClN3O2/c1-7-9(8-2-5-13(19)18-14(8)20)6-11-10(16-7)3-4-12(15)17-11/h3-4,6,8H,2,5H2,1H3,(H,18,19,20) |
| InChIKey | JIHRKNCHOAPDIE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|