C25H31N3O3 — CID 177017584
3-[6-(5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-2-methylquinolin-3-yl]piperidine-2,6-dione (PubChem CID 177017584) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-[6-(5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-2-methylquinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-2-methylquinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017584 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-[6-(5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-2-methylquinolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2ccc(C3(O)CCNCC34CCCCC4)cc2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H31N3O3/c1-16-20(19-6-8-22(29)28-23(19)30)14-17-13-18(5-7-21(17)27-16)25(31)11-12-26-15-24(25)9-3-2-4-10-24/h5,7,13-14,19,26,31H,2-4,6,8-12,15H2,1H3,(H,28,29,30) |
| InChIKey | OOHVGRHLIOGIIP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|