C22H27N3O4 — CID 177016434
3-[6-[4-hydroxy-3-(methoxymethyl)-3-methylpiperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016434) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[6-[4-hydroxy-3-(methoxymethyl)-3-methylpiperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-hydroxy-3-(methoxymethyl)-3-methylpiperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016434 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-[6-[4-hydroxy-3-(methoxymethyl)-3-methylpiperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | COCC1(C)CNCCC1(O)c1ccc2ncc(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C22H27N3O4/c1-21(13-29-2)12-23-8-7-22(21,28)16-3-5-18-14(10-16)9-15(11-24-18)17-4-6-19(26)25-20(17)27/h3,5,9-11,17,23,28H,4,6-8,12-13H2,1-2H3,(H,25,26,27) |
| InChIKey | GKYBTAMPTWMCIG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|