C30H32F3N3O3 — CID 177016170
3-[6-[4-hydroxy-3-propyl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016170) has the molecular formula C30H32F3N3O3 and a molecular weight of 539.60 g/mol. Its IUPAC name is 3-[6-[4-hydroxy-3-propyl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-hydroxy-3-propyl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016170 |
| Molecular Formula | C30H32F3N3O3 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 3-[6-[4-hydroxy-3-propyl-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | CCCC1CN(Cc2ccc(C(F)(F)F)cc2)CCC1(O)c1ccc2ncc(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C30H32F3N3O3/c1-2-3-24-18-36(17-19-4-6-22(7-5-19)30(31,32)33)13-12-29(24,39)23-8-10-26-20(15-23)14-21(16-34-26)25-9-11-27(37)35-28(25)38/h4-8,10,14-16,24-25,39H,2-3,9,11-13,17-18H2,1H3,(H,35,37,38) |
| InChIKey | WGYDPBARAKLGDP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|